decyl 2-ethylhexanoate

🙚 Home 🙚 Tables for Chemistry 🙘 Compound classes 🙘

decyl 2-ethylhexanoate
Formula:C18H36O2; 284.48 g/mol
InChiKey:NPTQTLMUAAVGNU-UHFFFAOYSA-N
SMILES:CCCCCCCCCCOC(=O)C(CC)CCCC
Molecular structure of decyl 2-ethylhexanoate

Isomers

decyl 2-ethylhexanoate
Molecular structure of decyl 2-ethylhexanoate
ethyl hexadecanoate
Molecular structure of ethyl hexadecanoate
1-hexadecyl acetate
Molecular structure of 1-hexadecyl acetate
hexyl dodecanoate
Molecular structure of hexyl dodecanoate
methyl heptadecanoate
Molecular structure of methyl heptadecanoate
octadecanoic acid
Molecular structure of octadecanoic acid
2-octyldecanoic acid
Molecular structure of 2-octyldecanoic acid
  ::